C34H41ClN2O7 — CID 163009559
N-[3-[(3-chloro-4-methoxyphenyl)methyl]-5-methyl-2,4-dioxopiperidin-3-yl]-5-hydroxy-N-(2-hydroxypentanoyl)-6-methyl-8-phenylocta-2,7-dienamide (PubChem CID 163009559) has the molecular formula C34H41ClN2O7 and a molecular weight of 625.16 g/mol. Its IUPAC name is N-[3-[(3-chloro-4-methoxyphenyl)methyl]-5-methyl-2,4-dioxopiperidin-3-yl]-5-hydroxy-N-(2-hydroxypentanoyl)-6-methyl-8-phenylocta-2,7-dienamide.
| Compound Name | N-[3-[(3-chloro-4-methoxyphenyl)methyl]-5-methyl-2,4-dioxopiperidin-3-yl]-5-hydroxy-N-(2-hydroxypentanoyl)-6-methyl-8-phenylocta-2,7-dienamide |
|---|---|
| PubChem CID | 163009559 |
| Molecular Formula | C34H41ClN2O7 |
| Molecular Weight | 625.16 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | N-[3-[(3-chloro-4-methoxyphenyl)methyl]-5-methyl-2,4-dioxopiperidin-3-yl]-5-hydroxy-N-(2-hydroxypentanoyl)-6-methyl-8-phenylocta-2,7-dienamide |
| SMILES | CCCC(O)C(=O)N(C(=O)C=CCC(O)C(C)C=Cc1ccccc1)C1(Cc2ccc(OC)c(Cl)c2)C(=O)NCC(C)C1=O |
| InChI | InChI=1S/C34H41ClN2O7/c1-5-10-28(39)32(42)37(30(40)14-9-13-27(38)22(2)15-16-24-11-7-6-8-12-24)34(31(41)23(3)21-36-33(34)43)20-25-17-18-29(44-4)26(35)19-25/h6-9,11-12,14-19,22-23,27-28,38-39H,5,10,13,20-21H2,1-4H3,(H,36,43) |
| InChIKey | RBCSETOQSCIXRX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.16 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|