C15H24O5 — CID 163009681
(4R,6R,7R)-4-[(1R,2S)-2-hydroxy-4-(hydroxymethyl)-1-methylcyclohex-3-en-1-yl]-4-methyl-1-oxaspiro[2.4]heptane-6,7-diol (PubChem CID 163009681) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (4R,6R,7R)-4-[(1R,2S)-2-hydroxy-4-(hydroxymethyl)-1-methylcyclohex-3-en-1-yl]-4-methyl-1-oxaspiro[2.4]heptane-6,7-diol.
| Compound Name | (4R,6R,7R)-4-[(1R,2S)-2-hydroxy-4-(hydroxymethyl)-1-methylcyclohex-3-en-1-yl]-4-methyl-1-oxaspiro[2.4]heptane-6,7-diol |
|---|---|
| PubChem CID | 163009681 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (4R,6R,7R)-4-[(1R,2S)-2-hydroxy-4-(hydroxymethyl)-1-methylcyclohex-3-en-1-yl]-4-methyl-1-oxaspiro[2.4]heptane-6,7-diol |
| SMILES | C[C@]1([C@@]2(C)C[C@@H](O)[C@@H](O)C23CO3)CCC(CO)=C[C@@H]1O |
| InChI | InChI=1S/C15H24O5/c1-13(4-3-9(7-16)5-11(13)18)14(2)6-10(17)12(19)15(14)8-20-15/h5,10-12,16-19H,3-4,6-8H2,1-2H3/t10-,11+,12-,13+,14-,15?/m1/s1 |
| InChIKey | YBDJTTMFBKYZDQ-WQFUOLRDSA-N |
| XLogP | -0.03 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|