C13H24O2 — CID 163009898
(1R,4R)-4-[(3S)-3-hydroxybutyl]-3,5,5-trimethylcyclohex-2-en-1-ol (PubChem CID 163009898) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (1R,4R)-4-[(3S)-3-hydroxybutyl]-3,5,5-trimethylcyclohex-2-en-1-ol.
| Compound Name | (1R,4R)-4-[(3S)-3-hydroxybutyl]-3,5,5-trimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 163009898 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (1R,4R)-4-[(3S)-3-hydroxybutyl]-3,5,5-trimethylcyclohex-2-en-1-ol |
| SMILES | CC1=C[C@H](O)CC(C)(C)[C@H]1CC[C@H](C)O |
| InChI | InChI=1S/C13H24O2/c1-9-7-11(15)8-13(3,4)12(9)6-5-10(2)14/h7,10-12,14-15H,5-6,8H2,1-4H3/t10-,11-,12-/m0/s1 |
| InChIKey | QKABGCVKXNSYJM-SRVKXCTJSA-N |
| XLogP | 2.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|