C13H24O3 — CID 163010409
4-(3,4-dihydroxybutyl)-3,3,5-trimethylcyclohexan-1-one (PubChem CID 163010409) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 4-(3,4-dihydroxybutyl)-3,3,5-trimethylcyclohexan-1-one.
| Compound Name | 4-(3,4-dihydroxybutyl)-3,3,5-trimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 163010409 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 4-(3,4-dihydroxybutyl)-3,3,5-trimethylcyclohexan-1-one |
| SMILES | CC1CC(=O)CC(C)(C)C1CCC(O)CO |
| InChI | InChI=1S/C13H24O3/c1-9-6-11(16)7-13(2,3)12(9)5-4-10(15)8-14/h9-10,12,14-15H,4-8H2,1-3H3 |
| InChIKey | FOSUKCDJIDFQKX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |