C20H28O11 — CID 163010536
[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl (2R)-2-acetyloxy-3-hydroxy-3-methylbutanoate (PubChem CID 163010536) has the molecular formula C20H28O11 and a molecular weight of 444.43 g/mol. Its IUPAC name is [4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl (2R)-2-acetyloxy-3-hydroxy-3-methylbutanoate.
| Compound Name | [4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl (2R)-2-acetyloxy-3-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 163010536 |
| Molecular Formula | C20H28O11 |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl (2R)-2-acetyloxy-3-hydroxy-3-methylbutanoate |
| SMILES | CC(=O)O[C@@H](C(=O)OCc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1)C(C)(C)O |
| InChI | InChI=1S/C20H28O11/c1-10(22)29-17(20(2,3)27)18(26)28-9-11-4-6-12(7-5-11)30-19-16(25)15(24)14(23)13(8-21)31-19/h4-7,13-17,19,21,23-25,27H,8-9H2,1-3H3/t13-,14-,15+,16-,17+,19-/m1/s1 |
| InChIKey | RXXZTHWYSQOQKC-FJANGAQTSA-N |
| XLogP | -1.39 |
| TPSA | 172.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |