C20H22O6 — CID 163010650
(9-methyl-3-methylidene-2,7-dioxospiro[3a,4,5,6a,9a,9b-hexahydroazuleno[4,5-b]furan-6,2'-oxirane]-4-yl) 2-methylbut-2-enoate (PubChem CID 163010650) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is (9-methyl-3-methylidene-2,7-dioxospiro[3a,4,5,6a,9a,9b-hexahydroazuleno[4,5-b]furan-6,2'-oxirane]-4-yl) 2-methylbut-2-enoate.
| Compound Name | (9-methyl-3-methylidene-2,7-dioxospiro[3a,4,5,6a,9a,9b-hexahydroazuleno[4,5-b]furan-6,2'-oxirane]-4-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163010650 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (9-methyl-3-methylidene-2,7-dioxospiro[3a,4,5,6a,9a,9b-hexahydroazuleno[4,5-b]furan-6,2'-oxirane]-4-yl) 2-methylbut-2-enoate |
| SMILES | C=C1C(=O)OC2C1C(OC(=O)C(C)=CC)CC1(CO1)C1C(=O)C=C(C)C21 |
| InChI | InChI=1S/C20H22O6/c1-5-9(2)18(22)25-13-7-20(8-24-20)16-12(21)6-10(3)14(16)17-15(13)11(4)19(23)26-17/h5-6,13-17H,4,7-8H2,1-3H3 |
| InChIKey | JBEHQABLKASLNK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|