C15H22O5 — CID 163011182
[(1R,2S,5S,6S,7R,8S)-2-hydroxy-5,6-dimethyl-12-oxo-11-oxatricyclo[5.3.2.01,6]dodecan-8-yl] acetate (PubChem CID 163011182) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is [(1R,2S,5S,6S,7R,8S)-2-hydroxy-5,6-dimethyl-12-oxo-11-oxatricyclo[5.3.2.01,6]dodecan-8-yl] acetate.
| Compound Name | [(1R,2S,5S,6S,7R,8S)-2-hydroxy-5,6-dimethyl-12-oxo-11-oxatricyclo[5.3.2.01,6]dodecan-8-yl] acetate |
|---|---|
| PubChem CID | 163011182 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | [(1R,2S,5S,6S,7R,8S)-2-hydroxy-5,6-dimethyl-12-oxo-11-oxatricyclo[5.3.2.01,6]dodecan-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]23OC(=O)[C@@H]1[C@]2(C)[C@@H](C)CC[C@@H]3O |
| InChI | InChI=1S/C15H22O5/c1-8-4-5-11(17)15-7-6-10(19-9(2)16)12(13(18)20-15)14(8,15)3/h8,10-12,17H,4-7H2,1-3H3/t8-,10-,11-,12+,14-,15-/m0/s1 |
| InChIKey | ZGLCXLBWVBASRA-ZZOQULRCSA-N |
| XLogP | 1.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |