About (2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one
(2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one (PubChem CID 163011213) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is (2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one.
Molecular Properties
| Compound Name | (2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one |
| PubChem CID | 163011213 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one |
| SMILES | CC(=O)[C@@H]1CC[C@@H](C)[C@H]1[C@H]1OC(=O)C=C1C(C)C |
| InChI | InChI=1S/C15H22O3/c1-8(2)12-7-13(17)18-15(12)14-9(3)5-6-11(14)10(4)16/h7-9,11,14-15H,5-6H2,1-4H3/t9-,11+,14-,15+/m1/s1 |
| InChIKey | XFPNWKDJTKUHLJ-QFEPDWEUSA-N |
| XLogP | 2.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one?
The IUPAC name of (2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one (CID 163011213) is (2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one.
What is the SMILES notation for (2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one?
The canonical SMILES for (2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one is CC(=O)[C@@H]1CC[C@@H](C)[C@H]1[C@H]1OC(=O)C=C1C(C)C.
What is the InChIKey of (2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one?
The InChIKey is XFPNWKDJTKUHLJ-QFEPDWEUSA-N. The full InChI is InChI=1S/C15H22O3/c1-8(2)12-7-13(17)18-15(12)14-9(3)5-6-11(14)10(4)16/h7-9,11,14-15H,5-6H2,1-4H3/t9-,11+,14-,15+/m1/s1.
What are the key properties of (2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one?
(2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one has a molecular weight of 250.34 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(1R,2R,5R)-2-acetyl-5-methylcyclopentyl]-3-propan-2-yl-2H-furan-5-one is sourced from PubChem (CID 163011213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).