C25H32O8 — CID 163011337
trans-(4S,6S)-4-butanoyl-6-[[(1R,5R)-5-butanoyl-3,3-dimethyl-2,4,6-trioxocyclohexyl]methyl]-2,2-dimethylcyclohexane-1,3,5-trione (PubChem CID 163011337) has the molecular formula C25H32O8 and a molecular weight of 460.52 g/mol. Its IUPAC name is trans-(4S,6S)-4-butanoyl-6-[[(1R,5R)-5-butanoyl-3,3-dimethyl-2,4,6-trioxocyclohexyl]methyl]-2,2-dimethylcyclohexane-1,3,5-trione.
| Compound Name | trans-(4S,6S)-4-butanoyl-6-[[(1R,5R)-5-butanoyl-3,3-dimethyl-2,4,6-trioxocyclohexyl]methyl]-2,2-dimethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 163011337 |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | trans-(4S,6S)-4-butanoyl-6-[[(1R,5R)-5-butanoyl-3,3-dimethyl-2,4,6-trioxocyclohexyl]methyl]-2,2-dimethylcyclohexane-1,3,5-trione |
| SMILES | CCCC(=O)[C@@H]1C(=O)[C@@H](C[C@H]2C(=O)[C@H](C(=O)CCC)C(=O)C(C)(C)C2=O)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C25H32O8/c1-7-9-14(26)16-18(28)12(20(30)24(3,4)22(16)32)11-13-19(29)17(15(27)10-8-2)23(33)25(5,6)21(13)31/h12-13,16-17H,7-11H2,1-6H3/t12-,13+,16-,17+ |
| InChIKey | ZHPLIOLOHFYBKM-AZQPONJRSA-N |
| XLogP | 2.07 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|