C23H28O12 — CID 163011344
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[(2S)-1-hydroxypropan-2-yl]-2-methoxyphenoxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate (PubChem CID 163011344) has the molecular formula C23H28O12 and a molecular weight of 496.47 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[(2S)-1-hydroxypropan-2-yl]-2-methoxyphenoxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[(2S)-1-hydroxypropan-2-yl]-2-methoxyphenoxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 163011344 |
| Molecular Formula | C23H28O12 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[(2S)-1-hydroxypropan-2-yl]-2-methoxyphenoxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
| SMILES | COc1cc([C@H](C)CO)ccc1O[C@@H]1O[C@H](COC(=O)c2cc(O)c(O)c(O)c2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H28O12/c1-10(8-24)11-3-4-15(16(7-11)32-2)34-23-21(30)20(29)19(28)17(35-23)9-33-22(31)12-5-13(25)18(27)14(26)6-12/h3-7,10,17,19-21,23-30H,8-9H2,1-2H3/t10-,17-,19-,20+,21-,23-/m1/s1 |
| InChIKey | GDYHXYVZYNLODJ-VCVSROJCSA-N |
| XLogP | -0.05 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|