C30H44O5 — CID 163011498
[17-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)ethyl]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate (PubChem CID 163011498) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is [17-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)ethyl]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate.
| Compound Name | [17-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)ethyl]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 163011498 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | [17-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)ethyl]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate |
| SMILES | CC(=O)OC1CC(O)CC2=CCC3C4CCC(C(C)C5CC(C)=C(C)C(=O)O5)C4(C)CCC3C21C |
| InChI | InChI=1S/C30H44O5/c1-16-13-26(35-28(33)17(16)2)18(3)23-9-10-24-22-8-7-20-14-21(32)15-27(34-19(4)31)30(20,6)25(22)11-12-29(23,24)5/h7,18,21-27,32H,8-15H2,1-6H3 |
| InChIKey | YROWEILPQZMTTI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|