C24H38O6 — CID 163011736
[(1R,2S,4R,5S)-4-acetyloxy-2-[(2R,4R)-4-acetyloxy-6-methylhept-5-en-2-yl]-5-methylcyclohexyl] (Z)-2-methylbut-2-enoate (PubChem CID 163011736) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is [(1R,2S,4R,5S)-4-acetyloxy-2-[(2R,4R)-4-acetyloxy-6-methylhept-5-en-2-yl]-5-methylcyclohexyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,2S,4R,5S)-4-acetyloxy-2-[(2R,4R)-4-acetyloxy-6-methylhept-5-en-2-yl]-5-methylcyclohexyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163011736 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | [(1R,2S,4R,5S)-4-acetyloxy-2-[(2R,4R)-4-acetyloxy-6-methylhept-5-en-2-yl]-5-methylcyclohexyl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1C[C@H](C)[C@H](OC(C)=O)C[C@H]1[C@H](C)C[C@H](C=C(C)C)OC(C)=O |
| InChI | InChI=1S/C24H38O6/c1-9-15(4)24(27)30-23-12-17(6)22(29-19(8)26)13-21(23)16(5)11-20(10-14(2)3)28-18(7)25/h9-10,16-17,20-23H,11-13H2,1-8H3/b15-9-/t16-,17+,20+,21+,22-,23-/m1/s1 |
| InChIKey | ZIISMZIZMXGTAW-AADZIFALSA-N |
| XLogP | 4.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|