C21H32O6 — CID 163011911
[(1S,2S,4R,8S,9R,11R)-1-ethoxy-2,11-dimethyl-7-methylidene-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate (PubChem CID 163011911) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is [(1S,2S,4R,8S,9R,11R)-1-ethoxy-2,11-dimethyl-7-methylidene-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate.
| Compound Name | [(1S,2S,4R,8S,9R,11R)-1-ethoxy-2,11-dimethyl-7-methylidene-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 163011911 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [(1S,2S,4R,8S,9R,11R)-1-ethoxy-2,11-dimethyl-7-methylidene-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@@H]2C[C@H](C)[C@]3(OCC)CC[C@](C)(C[C@@H](OC(=O)C(C)C)[C@@H]12)O3 |
| InChI | InChI=1S/C21H32O6/c1-7-24-21-9-8-20(6,27-21)11-16(26-18(22)12(2)3)17-14(5)19(23)25-15(17)10-13(21)4/h12-13,15-17H,5,7-11H2,1-4,6H3/t13-,15+,16+,17-,20+,21-/m0/s1 |
| InChIKey | CASQLMHFEQKREM-KESHLRAWSA-N |
| XLogP | 3.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|