C22H30O4 — CID 163012402
[(Z)-[(1S,3Z,5E,8S,11R)-6-methyl-11-[(2S)-6-methylhept-5-en-2-yl]-10-oxo-9-oxabicyclo[6.2.1]undeca-3,5-dien-2-ylidene]methyl] acetate (PubChem CID 163012402) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(Z)-[(1S,3Z,5E,8S,11R)-6-methyl-11-[(2S)-6-methylhept-5-en-2-yl]-10-oxo-9-oxabicyclo[6.2.1]undeca-3,5-dien-2-ylidene]methyl] acetate.
| Compound Name | [(Z)-[(1S,3Z,5E,8S,11R)-6-methyl-11-[(2S)-6-methylhept-5-en-2-yl]-10-oxo-9-oxabicyclo[6.2.1]undeca-3,5-dien-2-ylidene]methyl] acetate |
|---|---|
| PubChem CID | 163012402 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(Z)-[(1S,3Z,5E,8S,11R)-6-methyl-11-[(2S)-6-methylhept-5-en-2-yl]-10-oxo-9-oxabicyclo[6.2.1]undeca-3,5-dien-2-ylidene]methyl] acetate |
| SMILES | CC(=O)O/C=C1/C=C\C=C(\C)C[C@@H]2OC(=O)[C@H]1[C@H]2[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C22H30O4/c1-14(2)8-6-10-16(4)20-19-12-15(3)9-7-11-18(13-25-17(5)23)21(20)22(24)26-19/h7-9,11,13,16,19-21H,6,10,12H2,1-5H3/b11-7-,15-9-,18-13-/t16-,19-,20-,21+/m0/s1 |
| InChIKey | PUSGGIDEGQFCFM-AYXJAAQOSA-N |
| XLogP | 4.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|