C15H19NO — CID 163012805
1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4,6,8-tetraen-1-one (PubChem CID 163012805) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4,6,8-tetraen-1-one.
| Compound Name | 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4,6,8-tetraen-1-one |
|---|---|
| PubChem CID | 163012805 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyridin-1-yl)deca-2,4,6,8-tetraen-1-one |
| SMILES | CC=CC=CC=CC=CC(=O)N1C=CCCC1 |
| InChI | InChI=1S/C15H19NO/c1-2-3-4-5-6-7-9-12-15(17)16-13-10-8-11-14-16/h2-7,9-10,12-13H,8,11,14H2,1H3 |
| InChIKey | JLBTYPJRECBOEI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|