C16H24O6 — CID 163012822
(3Z,5R,8R,11Z,14S,16R)-5,14-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione (PubChem CID 163012822) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (3Z,5R,8R,11Z,14S,16R)-5,14-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione.
| Compound Name | (3Z,5R,8R,11Z,14S,16R)-5,14-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione |
|---|---|
| PubChem CID | 163012822 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3Z,5R,8R,11Z,14S,16R)-5,14-dihydroxy-8,16-dimethyl-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione |
| SMILES | C[C@@H]1CC[C@@H](O)/C=C\C(=O)O[C@H](C)C[C@@H](O)C/C=C\C(=O)O1 |
| InChI | InChI=1S/C16H24O6/c1-11-6-7-13(17)8-9-16(20)22-12(2)10-14(18)4-3-5-15(19)21-11/h3,5,8-9,11-14,17-18H,4,6-7,10H2,1-2H3/b5-3-,9-8-/t11-,12-,13-,14+/m1/s1 |
| InChIKey | PSCNDCPGXQLFJQ-NRIBBXCKSA-N |
| XLogP | 1.26 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |