C19H19NO4 — CID 163012859
20-methoxy-5,7-dioxa-14-azapentacyclo[12.7.0.01,17.02,10.04,8]henicosa-2,4(8),9,16,18-pentaen-11-one (PubChem CID 163012859) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 20-methoxy-5,7-dioxa-14-azapentacyclo[12.7.0.01,17.02,10.04,8]henicosa-2,4(8),9,16,18-pentaen-11-one.
| Compound Name | 20-methoxy-5,7-dioxa-14-azapentacyclo[12.7.0.01,17.02,10.04,8]henicosa-2,4(8),9,16,18-pentaen-11-one |
|---|---|
| PubChem CID | 163012859 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 20-methoxy-5,7-dioxa-14-azapentacyclo[12.7.0.01,17.02,10.04,8]henicosa-2,4(8),9,16,18-pentaen-11-one |
| SMILES | COC1C=CC2=CCN3CCC(=O)c4cc5c(cc4C23C1)OCO5 |
| InChI | InChI=1S/C19H19NO4/c1-22-13-3-2-12-4-6-20-7-5-16(21)14-8-17-18(24-11-23-17)9-15(14)19(12,20)10-13/h2-4,8-9,13H,5-7,10-11H2,1H3 |
| InChIKey | DOJXTMYNRCGFBG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |