C25H38O4 — CID 163012964
[4-acetyl-7-formyl-5,10-dimethyl-5-(6-methylhept-5-en-2-yl)-10-bicyclo[4.3.1]dec-7-enyl] acetate (PubChem CID 163012964) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is [4-acetyl-7-formyl-5,10-dimethyl-5-(6-methylhept-5-en-2-yl)-10-bicyclo[4.3.1]dec-7-enyl] acetate.
| Compound Name | [4-acetyl-7-formyl-5,10-dimethyl-5-(6-methylhept-5-en-2-yl)-10-bicyclo[4.3.1]dec-7-enyl] acetate |
|---|---|
| PubChem CID | 163012964 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | [4-acetyl-7-formyl-5,10-dimethyl-5-(6-methylhept-5-en-2-yl)-10-bicyclo[4.3.1]dec-7-enyl] acetate |
| SMILES | CC(=O)OC1(C)C2CC=C(C=O)C1C(C)(C(C)CCC=C(C)C)C(C(C)=O)CC2 |
| InChI | InChI=1S/C25H38O4/c1-16(2)9-8-10-17(3)24(6)22(18(4)27)14-13-21-12-11-20(15-26)23(24)25(21,7)29-19(5)28/h9,11,15,17,21-23H,8,10,12-14H2,1-7H3 |
| InChIKey | HPSPFNDWQCDWLW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|