C20H24O6 — CID 163013049
4-[[4-[(3,5-dimethoxyphenyl)-hydroxymethyl]oxolan-3-yl]methyl]benzene-1,2-diol (PubChem CID 163013049) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-[[4-[(3,5-dimethoxyphenyl)-hydroxymethyl]oxolan-3-yl]methyl]benzene-1,2-diol.
| Compound Name | 4-[[4-[(3,5-dimethoxyphenyl)-hydroxymethyl]oxolan-3-yl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 163013049 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 4-[[4-[(3,5-dimethoxyphenyl)-hydroxymethyl]oxolan-3-yl]methyl]benzene-1,2-diol |
| SMILES | COc1cc(OC)cc(C(O)C2COCC2Cc2ccc(O)c(O)c2)c1 |
| InChI | InChI=1S/C20H24O6/c1-24-15-7-13(8-16(9-15)25-2)20(23)17-11-26-10-14(17)5-12-3-4-18(21)19(22)6-12/h3-4,6-9,14,17,20-23H,5,10-11H2,1-2H3 |
| InChIKey | XVAZATVWTAESBZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|