C16H24O3 — CID 163013082
methyl (E,6R)-2-methyl-6-[(1S)-4-methyl-2-oxocyclohex-3-en-1-yl]hept-2-enoate (PubChem CID 163013082) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is methyl (E,6R)-2-methyl-6-[(1S)-4-methyl-2-oxocyclohex-3-en-1-yl]hept-2-enoate.
| Compound Name | methyl (E,6R)-2-methyl-6-[(1S)-4-methyl-2-oxocyclohex-3-en-1-yl]hept-2-enoate |
|---|---|
| PubChem CID | 163013082 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl (E,6R)-2-methyl-6-[(1S)-4-methyl-2-oxocyclohex-3-en-1-yl]hept-2-enoate |
| SMILES | COC(=O)/C(C)=C/CC[C@@H](C)[C@@H]1CCC(C)=CC1=O |
| InChI | InChI=1S/C16H24O3/c1-11-8-9-14(15(17)10-11)12(2)6-5-7-13(3)16(18)19-4/h7,10,12,14H,5-6,8-9H2,1-4H3/b13-7+/t12-,14+/m1/s1 |
| InChIKey | OJRHQPUPEZWDBF-DQLFRSJESA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|