C15H18O — CID 163013140
(3S,8E,10E)-pentadeca-8,10,14-trien-4,6-diyn-3-ol (PubChem CID 163013140) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (3S,8E,10E)-pentadeca-8,10,14-trien-4,6-diyn-3-ol.
| Compound Name | (3S,8E,10E)-pentadeca-8,10,14-trien-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 163013140 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (3S,8E,10E)-pentadeca-8,10,14-trien-4,6-diyn-3-ol |
| SMILES | C=CCC/C=C/C=C/C#CC#C[C@@H](O)CC |
| InChI | InChI=1S/C15H18O/c1-3-5-6-7-8-9-10-11-12-13-14-15(16)4-2/h3,7-10,15-16H,1,4-6H2,2H3/b8-7+,10-9+/t15-/m0/s1 |
| InChIKey | PPECZXSSUPUVQR-IMVYBZFCSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|