C22H22O4 — CID 163013400
(6S)-10,10-dimethyl-6-prop-1-en-2-yl-5,6-dihydronaphtho[2,1-g]chromene-2,3,7-triol (PubChem CID 163013400) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is (6S)-10,10-dimethyl-6-prop-1-en-2-yl-5,6-dihydronaphtho[2,1-g]chromene-2,3,7-triol.
| Compound Name | (6S)-10,10-dimethyl-6-prop-1-en-2-yl-5,6-dihydronaphtho[2,1-g]chromene-2,3,7-triol |
|---|---|
| PubChem CID | 163013400 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (6S)-10,10-dimethyl-6-prop-1-en-2-yl-5,6-dihydronaphtho[2,1-g]chromene-2,3,7-triol |
| SMILES | C=C(C)[C@@H]1Cc2cc(O)c(O)cc2-c2cc3c(c(O)c21)C=CC(C)(C)O3 |
| InChI | InChI=1S/C22H22O4/c1-11(2)14-7-12-8-17(23)18(24)9-15(12)16-10-19-13(21(25)20(14)16)5-6-22(3,4)26-19/h5-6,8-10,14,23-25H,1,7H2,2-4H3/t14-/m0/s1 |
| InChIKey | HPKFHYBIRLSUCD-AWEZNQCLSA-N |
| XLogP | 4.87 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|