C29H46O4 — CID 163014071
methyl 3-[(3S,3aR,5aR,6S,7S,9aR,9bS)-3a,6,9a,9b-tetramethyl-3-[(2R)-2-methyl-5-oxooxolan-2-yl]-7-prop-1-en-2-yl-2,3,4,5,5a,7,8,9-octahydro-1H-cyclopenta[a]naphthalen-6-yl]propanoate (PubChem CID 163014071) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is methyl 3-[(3S,3aR,5aR,6S,7S,9aR,9bS)-3a,6,9a,9b-tetramethyl-3-[(2R)-2-methyl-5-oxooxolan-2-yl]-7-prop-1-en-2-yl-2,3,4,5,5a,7,8,9-octahydro-1H-cyclopenta[a]naphthalen-6-yl]propanoate.
| Compound Name | methyl 3-[(3S,3aR,5aR,6S,7S,9aR,9bS)-3a,6,9a,9b-tetramethyl-3-[(2R)-2-methyl-5-oxooxolan-2-yl]-7-prop-1-en-2-yl-2,3,4,5,5a,7,8,9-octahydro-1H-cyclopenta[a]naphthalen-6-yl]propanoate |
|---|---|
| PubChem CID | 163014071 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | methyl 3-[(3S,3aR,5aR,6S,7S,9aR,9bS)-3a,6,9a,9b-tetramethyl-3-[(2R)-2-methyl-5-oxooxolan-2-yl]-7-prop-1-en-2-yl-2,3,4,5,5a,7,8,9-octahydro-1H-cyclopenta[a]naphthalen-6-yl]propanoate |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)[C@H](CC[C@]3(C)[C@@H]([C@@]4(C)CCC(=O)O4)CC[C@@]23C)[C@@]1(C)CCC(=O)OC |
| InChI | InChI=1S/C29H46O4/c1-19(2)20-9-15-26(4)21(25(20,3)14-12-23(30)32-8)10-16-27(5)22(11-18-29(26,27)7)28(6)17-13-24(31)33-28/h20-22H,1,9-18H2,2-8H3/t20-,21+,22-,25-,26+,27+,28+,29-/m0/s1 |
| InChIKey | KIMMGHVVFFFJPX-SODAFGKNSA-N |
| XLogP | 6.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|