C14H18O3 — CID 163014284
(E,2R,3S)-1-[(1R)-1,3-dihydro-2-benzofuran-1-yl]hex-4-ene-2,3-diol (PubChem CID 163014284) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is (E,2R,3S)-1-[(1R)-1,3-dihydro-2-benzofuran-1-yl]hex-4-ene-2,3-diol.
| Compound Name | (E,2R,3S)-1-[(1R)-1,3-dihydro-2-benzofuran-1-yl]hex-4-ene-2,3-diol |
|---|---|
| PubChem CID | 163014284 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (E,2R,3S)-1-[(1R)-1,3-dihydro-2-benzofuran-1-yl]hex-4-ene-2,3-diol |
| SMILES | C/C=C/[C@H](O)[C@H](O)C[C@H]1OCc2ccccc21 |
| InChI | InChI=1S/C14H18O3/c1-2-5-12(15)13(16)8-14-11-7-4-3-6-10(11)9-17-14/h2-7,12-16H,8-9H2,1H3/b5-2+/t12-,13+,14+/m0/s1 |
| InChIKey | VVDFJJZWKCQBJC-AIVBWKQFSA-N |
| XLogP | 1.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|