About CID 163014800
CID 163014800 (PubChem CID 163014800) has the molecular formula C21H32O5
and a molecular weight of 364.48 g/mol.
Molecular Properties
| Compound Name | CID 163014800 |
| PubChem CID | 163014800 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | — |
| SMILES | CO[C@H]1C[C@@]2(CC[C@@]3(O2)[C@H](C)C[C@H]2OC(=O)[C@@]4(C)CCC[C@@]3(C)[C@@H]24)CO1 |
| InChI | InChI=1S/C21H32O5/c1-13-10-14-16-18(2,17(22)25-14)6-5-7-19(16,3)21(13)9-8-20(26-21)11-15(23-4)24-12-20/h13-16H,5-12H2,1-4H3/t13-,14-,15-,16+,18+,19+,20+,21-/m1/s1 |
| InChIKey | QBCPPXUWUDONEX-MQUYVMPGSA-N |
| XLogP | 3.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 163014800 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163014800?
The IUPAC name of CID 163014800 (CID 163014800) is not available.
What is the SMILES notation for CID 163014800?
The canonical SMILES for CID 163014800 is CO[C@H]1C[C@@]2(CC[C@@]3(O2)[C@H](C)C[C@H]2OC(=O)[C@@]4(C)CCC[C@@]3(C)[C@@H]24)CO1.
What is the InChIKey of CID 163014800?
The InChIKey is QBCPPXUWUDONEX-MQUYVMPGSA-N. The full InChI is InChI=1S/C21H32O5/c1-13-10-14-16-18(2,17(22)25-14)6-5-7-19(16,3)21(13)9-8-20(26-21)11-15(23-4)24-12-20/h13-16H,5-12H2,1-4H3/t13-,14-,15-,16+,18+,19+,20+,21-/m1/s1.
What are the key properties of CID 163014800?
CID 163014800 has a molecular weight of 364.48 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163014800 is sourced from PubChem (CID 163014800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).