C21H23NO3 — CID 163015067
5-(5-hydroxy-4-methoxy-7,8-dihydronaphthalen-1-yl)-1-methyl-1,2,3,4-tetrahydroisoquinolin-8-ol (PubChem CID 163015067) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 5-(5-hydroxy-4-methoxy-7,8-dihydronaphthalen-1-yl)-1-methyl-1,2,3,4-tetrahydroisoquinolin-8-ol.
| Compound Name | 5-(5-hydroxy-4-methoxy-7,8-dihydronaphthalen-1-yl)-1-methyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
|---|---|
| PubChem CID | 163015067 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 5-(5-hydroxy-4-methoxy-7,8-dihydronaphthalen-1-yl)-1-methyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
| SMILES | COc1ccc(-c2ccc(O)c3c2CCNC3C)c2c1C(O)=CCC2 |
| InChI | InChI=1S/C21H23NO3/c1-12-20-16(10-11-22-12)13(6-8-18(20)24)14-7-9-19(25-2)21-15(14)4-3-5-17(21)23/h5-9,12,22-24H,3-4,10-11H2,1-2H3 |
| InChIKey | DYJGDVCTHGRZQM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|