C21H30O3 — CID 163015069
(3S,4R,5R)-3-hexadeca-9,11,15-trien-7-ynyl-4-hydroxy-5-methyloxolan-2-one (PubChem CID 163015069) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (3S,4R,5R)-3-hexadeca-9,11,15-trien-7-ynyl-4-hydroxy-5-methyloxolan-2-one.
| Compound Name | (3S,4R,5R)-3-hexadeca-9,11,15-trien-7-ynyl-4-hydroxy-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 163015069 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (3S,4R,5R)-3-hexadeca-9,11,15-trien-7-ynyl-4-hydroxy-5-methyloxolan-2-one |
| SMILES | C=CCCC=CC=CC#CCCCCCC[C@@H]1C(=O)O[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C21H30O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-20(22)18(2)24-21(19)23/h3,6-9,18-20,22H,1,4-5,12-17H2,2H3/t18-,19+,20+/m1/s1 |
| InChIKey | CJMUGJLGEQOFLP-AABGKKOBSA-N |
| XLogP | 4.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|