About [(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate
[(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate (PubChem CID 163015407) has the molecular formula C17H30O4
and a molecular weight of 298.42 g/mol. Its IUPAC name is [(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate.
Molecular Properties
| Compound Name | [(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate |
| PubChem CID | 163015407 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | [(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate |
| SMILES | O=C(CCCCCCCC[C@H]1C=CCC1)OC[C@@H](O)CO |
| InChI | InChI=1S/C17H30O4/c18-13-16(19)14-21-17(20)12-6-4-2-1-3-5-9-15-10-7-8-11-15/h7,10,15-16,18-19H,1-6,8-9,11-14H2/t15-,16-/m0/s1 |
| InChIKey | UZRAFOVPRMUAFS-HOTGVXAUSA-N |
| XLogP | 2.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate?
The IUPAC name of [(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate (CID 163015407) is [(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate.
What is the SMILES notation for [(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate?
The canonical SMILES for [(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate is O=C(CCCCCCCC[C@H]1C=CCC1)OC[C@@H](O)CO.
What is the InChIKey of [(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate?
The InChIKey is UZRAFOVPRMUAFS-HOTGVXAUSA-N. The full InChI is InChI=1S/C17H30O4/c18-13-16(19)14-21-17(20)12-6-4-2-1-3-5-9-15-10-7-8-11-15/h7,10,15-16,18-19H,1-6,8-9,11-14H2/t15-,16-/m0/s1.
What are the key properties of [(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate?
[(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate has a molecular weight of 298.42 g/mol, XLogP of 2.97, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2,3-dihydroxypropyl] 9-[(1R)-cyclopent-2-en-1-yl]nonanoate is sourced from PubChem (CID 163015407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).