C27H26O10 — CID 163015422
[(1R,9R,17R)-4,5,14-triacetyloxy-13-methoxy-8-oxo-17-tetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaenyl]methyl acetate (PubChem CID 163015422) has the molecular formula C27H26O10 and a molecular weight of 510.50 g/mol. Its IUPAC name is [(1R,9R,17R)-4,5,14-triacetyloxy-13-methoxy-8-oxo-17-tetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaenyl]methyl acetate.
| Compound Name | [(1R,9R,17R)-4,5,14-triacetyloxy-13-methoxy-8-oxo-17-tetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaenyl]methyl acetate |
|---|---|
| PubChem CID | 163015422 |
| Molecular Formula | C27H26O10 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | [(1R,9R,17R)-4,5,14-triacetyloxy-13-methoxy-8-oxo-17-tetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaenyl]methyl acetate |
| SMILES | COc1cc2c(cc1OC(C)=O)[C@@H]1c3cc(OC(C)=O)c(OC(C)=O)cc3C(=O)[C@H](C2)[C@@H]1COC(C)=O |
| InChI | InChI=1S/C27H26O10/c1-12(28)34-11-21-19-6-16-7-22(33-5)23(35-13(2)29)8-17(16)26(21)18-9-24(36-14(3)30)25(37-15(4)31)10-20(18)27(19)32/h7-10,19,21,26H,6,11H2,1-5H3/t19-,21+,26-/m1/s1 |
| InChIKey | KELYKXIEBFGAKA-BNIKKZEQSA-N |
| XLogP | 3.15 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|