C10H16N4O5 — CID 163016980
(2R)-2-[[(2S)-2-amino-3-[[(E)-4-amino-4-oxobut-2-enoyl]amino]propanoyl]amino]propanoic acid (PubChem CID 163016980) has the molecular formula C10H16N4O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-amino-3-[[(E)-4-amino-4-oxobut-2-enoyl]amino]propanoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-amino-3-[[(E)-4-amino-4-oxobut-2-enoyl]amino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 163016980 |
| Molecular Formula | C10H16N4O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | (2R)-2-[[(2S)-2-amino-3-[[(E)-4-amino-4-oxobut-2-enoyl]amino]propanoyl]amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)[C@@H](N)CNC(=O)/C=C/C(N)=O)C(=O)O |
| InChI | InChI=1S/C10H16N4O5/c1-5(10(18)19)14-9(17)6(11)4-13-8(16)3-2-7(12)15/h2-3,5-6H,4,11H2,1H3,(H2,12,15)(H,13,16)(H,14,17)(H,18,19)/b3-2+/t5-,6+/m1/s1 |
| InChIKey | XMSWOFBDXIPAAF-QQTLEDFYSA-N |
| XLogP | -2.94 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|