C17H28O2 — CID 163017329
[(1S,2R,5S,6S,7R,8S)-2,8-dimethyl-5-propan-2-yl-7-tricyclo[4.4.0.02,8]decanyl] acetate (PubChem CID 163017329) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is [(1S,2R,5S,6S,7R,8S)-2,8-dimethyl-5-propan-2-yl-7-tricyclo[4.4.0.02,8]decanyl] acetate.
| Compound Name | [(1S,2R,5S,6S,7R,8S)-2,8-dimethyl-5-propan-2-yl-7-tricyclo[4.4.0.02,8]decanyl] acetate |
|---|---|
| PubChem CID | 163017329 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | [(1S,2R,5S,6S,7R,8S)-2,8-dimethyl-5-propan-2-yl-7-tricyclo[4.4.0.02,8]decanyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2[C@H](C(C)C)CCC3(C)[C@H]2CC[C@]13C |
| InChI | InChI=1S/C17H28O2/c1-10(2)12-6-8-16(4)13-7-9-17(16,5)15(14(12)13)19-11(3)18/h10,12-15H,6-9H2,1-5H3/t12-,13-,14-,15+,16?,17+/m0/s1 |
| InChIKey | PGUZTNNGUYXANF-RVHJECSQSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |