C25H42O8 — CID 163017565
methyl (E,9R,12S,13S)-9,12,13-triacetyloxyoctadec-10-enoate (PubChem CID 163017565) has the molecular formula C25H42O8 and a molecular weight of 470.60 g/mol. Its IUPAC name is methyl (E,9R,12S,13S)-9,12,13-triacetyloxyoctadec-10-enoate.
| Compound Name | methyl (E,9R,12S,13S)-9,12,13-triacetyloxyoctadec-10-enoate |
|---|---|
| PubChem CID | 163017565 |
| Molecular Formula | C25H42O8 |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | methyl (E,9R,12S,13S)-9,12,13-triacetyloxyoctadec-10-enoate |
| SMILES | CCCCC[C@H](OC(C)=O)[C@H](/C=C/[C@@H](CCCCCCCC(=O)OC)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C25H42O8/c1-6-7-11-15-23(32-20(3)27)24(33-21(4)28)18-17-22(31-19(2)26)14-12-9-8-10-13-16-25(29)30-5/h17-18,22-24H,6-16H2,1-5H3/b18-17+/t22-,23+,24+/m1/s1 |
| InChIKey | BZLLAPVFQSKIRC-SDALJLPISA-N |
| XLogP | 4.82 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|