C19H26O5 — CID 163017566
(4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-3-yl) 2-methylpropanoate (PubChem CID 163017566) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-3-yl) 2-methylpropanoate.
| Compound Name | (4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-3-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 163017566 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-3-yl) 2-methylpropanoate |
| SMILES | C=C1C(=O)OC2C=C(C)CCC3OC3(C)C(OC(=O)C(C)C)CC12 |
| InChI | InChI=1S/C19H26O5/c1-10(2)17(20)23-16-9-13-12(4)18(21)22-14(13)8-11(3)6-7-15-19(16,5)24-15/h8,10,13-16H,4,6-7,9H2,1-3,5H3 |
| InChIKey | BGUBTIGWBFXLGY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|