C34H50O8 — CID 163017608
5-acetyloxy-6-(7-acetyloxy-15-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid (PubChem CID 163017608) has the molecular formula C34H50O8 and a molecular weight of 586.77 g/mol. Its IUPAC name is 5-acetyloxy-6-(7-acetyloxy-15-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid.
| Compound Name | 5-acetyloxy-6-(7-acetyloxy-15-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 163017608 |
| Molecular Formula | C34H50O8 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | 5-acetyloxy-6-(7-acetyloxy-15-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid |
| SMILES | CC(=O)OC1CC2C(C)(C)C(=O)CCC2(C)C2=C1C1(C)C(O)CC(C(C)C(CC=C(C)C(=O)O)OC(C)=O)C1(C)CC2 |
| InChI | InChI=1S/C34H50O8/c1-18(30(39)40)10-11-24(41-20(3)35)19(2)23-16-28(38)34(9)29-22(12-15-33(23,34)8)32(7)14-13-27(37)31(5,6)26(32)17-25(29)42-21(4)36/h10,19,23-26,28,38H,11-17H2,1-9H3,(H,39,40) |
| InChIKey | OVJVNUDIDQCECL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|