C23H23ClO6 — CID 163017923
[(6aR)-5-chloro-3-[(1E,3E,5R)-3,5-dimethylhepta-1,3-dienyl]-6a-methyl-6,8-dioxofuro[2,3-h]isochromen-9-yl] acetate (PubChem CID 163017923) has the molecular formula C23H23ClO6 and a molecular weight of 430.88 g/mol. Its IUPAC name is [(6aR)-5-chloro-3-[(1E,3E,5R)-3,5-dimethylhepta-1,3-dienyl]-6a-methyl-6,8-dioxofuro[2,3-h]isochromen-9-yl] acetate.
| Compound Name | [(6aR)-5-chloro-3-[(1E,3E,5R)-3,5-dimethylhepta-1,3-dienyl]-6a-methyl-6,8-dioxofuro[2,3-h]isochromen-9-yl] acetate |
|---|---|
| PubChem CID | 163017923 |
| Molecular Formula | C23H23ClO6 |
| Molecular Weight | 430.88 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | [(6aR)-5-chloro-3-[(1E,3E,5R)-3,5-dimethylhepta-1,3-dienyl]-6a-methyl-6,8-dioxofuro[2,3-h]isochromen-9-yl] acetate |
| SMILES | CC[C@@H](C)/C=C(C)/C=C/C1=CC2=C(Cl)C(=O)[C@]3(C)OC(=O)C(OC(C)=O)=C3C2=CO1 |
| InChI | InChI=1S/C23H23ClO6/c1-6-12(2)9-13(3)7-8-15-10-16-17(11-28-15)18-20(29-14(4)25)22(27)30-23(18,5)21(26)19(16)24/h7-12H,6H2,1-5H3/b8-7+,13-9+/t12-,23-/m1/s1 |
| InChIKey | DHKQPIFUIWJXRK-OYVYHWHUSA-N |
| XLogP | 4.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.88 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|