C19H32O3 — CID 163018164
[(8S,9S,11Z,14Z)-9-hydroxyheptadeca-1,11,14-trien-8-yl] acetate (PubChem CID 163018164) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is [(8S,9S,11Z,14Z)-9-hydroxyheptadeca-1,11,14-trien-8-yl] acetate.
| Compound Name | [(8S,9S,11Z,14Z)-9-hydroxyheptadeca-1,11,14-trien-8-yl] acetate |
|---|---|
| PubChem CID | 163018164 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | [(8S,9S,11Z,14Z)-9-hydroxyheptadeca-1,11,14-trien-8-yl] acetate |
| SMILES | C=CCCCCC[C@H](OC(C)=O)[C@@H](O)C/C=C\C/C=C\CC |
| InChI | InChI=1S/C19H32O3/c1-4-6-8-10-12-13-15-18(21)19(22-17(3)20)16-14-11-9-7-5-2/h5-6,8,12-13,18-19,21H,2,4,7,9-11,14-16H2,1,3H3/b8-6-,13-12-/t18-,19-/m0/s1 |
| InChIKey | RSVGLGCOMGQPBO-SXGROOGQSA-N |
| XLogP | 4.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|