C7H10O5 — CID 163018358
(3R,4R,5S,6S)-3,4,5,6-tetrahydroxycyclohexene-1-carbaldehyde (PubChem CID 163018358) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is (3R,4R,5S,6S)-3,4,5,6-tetrahydroxycyclohexene-1-carbaldehyde.
| Compound Name | (3R,4R,5S,6S)-3,4,5,6-tetrahydroxycyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 163018358 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (3R,4R,5S,6S)-3,4,5,6-tetrahydroxycyclohexene-1-carbaldehyde |
| SMILES | O=CC1=C[C@@H](O)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H10O5/c8-2-3-1-4(9)6(11)7(12)5(3)10/h1-2,4-7,9-12H/t4-,5+,6-,7+/m1/s1 |
| InChIKey | KQQCGAKRCKYICB-UCROKIRRSA-N |
| XLogP | -2.43 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|