C22H34O10 — CID 163018562
3-oxo-3-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R)-4-[(1S)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]butan-2-yl]oxyoxan-2-yl]methoxy]propanoic acid (PubChem CID 163018562) has the molecular formula C22H34O10 and a molecular weight of 458.50 g/mol. Its IUPAC name is 3-oxo-3-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R)-4-[(1S)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]butan-2-yl]oxyoxan-2-yl]methoxy]propanoic acid.
| Compound Name | 3-oxo-3-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R)-4-[(1S)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]butan-2-yl]oxyoxan-2-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 163018562 |
| Molecular Formula | C22H34O10 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 3-oxo-3-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R)-4-[(1S)-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]butan-2-yl]oxyoxan-2-yl]methoxy]propanoic acid |
| SMILES | CC1=CC(=O)CC(C)(C)[C@@H]1CC[C@@H](C)O[C@@H]1O[C@H](COC(=O)CC(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H34O10/c1-11-7-13(23)9-22(3,4)14(11)6-5-12(2)31-21-20(29)19(28)18(27)15(32-21)10-30-17(26)8-16(24)25/h7,12,14-15,18-21,27-29H,5-6,8-10H2,1-4H3,(H,24,25)/t12-,14-,15-,18-,19+,20-,21-/m1/s1 |
| InChIKey | IXYCPAHOLNUOGS-WCYHFLJESA-N |
| XLogP | 0.56 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|