C34H58 — CID 163018720
(3R,7R,10S,11E,13R,16R,19Z)-10-ethenyl-2,3,7,10,13,16,20,21-octamethyl-6,17-dimethylidenedocosa-1,11,19-triene (PubChem CID 163018720) has the molecular formula C34H58 and a molecular weight of 466.84 g/mol. Its IUPAC name is (3R,7R,10S,11E,13R,16R,19Z)-10-ethenyl-2,3,7,10,13,16,20,21-octamethyl-6,17-dimethylidenedocosa-1,11,19-triene.
| Compound Name | (3R,7R,10S,11E,13R,16R,19Z)-10-ethenyl-2,3,7,10,13,16,20,21-octamethyl-6,17-dimethylidenedocosa-1,11,19-triene |
|---|---|
| PubChem CID | 163018720 |
| Molecular Formula | C34H58 |
| Molecular Weight | 466.84 g/mol |
| Exact Mass | 466.45 |
| IUPAC Name | (3R,7R,10S,11E,13R,16R,19Z)-10-ethenyl-2,3,7,10,13,16,20,21-octamethyl-6,17-dimethylidenedocosa-1,11,19-triene |
| SMILES | C=C[C@@](C)(/C=C/[C@H](C)CC[C@@H](C)C(=C)C/C=C(/C)C(C)C)CC[C@@H](C)C(=C)CC[C@@H](C)C(=C)C |
| InChI | InChI=1S/C34H58/c1-14-34(13,24-22-33(12)32(11)20-18-29(8)26(4)5)23-21-27(6)15-16-30(9)31(10)19-17-28(7)25(2)3/h14,17,21,23,25,27,29-30,33H,1,4,10-11,15-16,18-20,22,24H2,2-3,5-9,12-13H3/b23-21+,28-17-/t27-,29-,30-,33-,34+/m1/s1 |
| InChIKey | ZYBDFTCDDVBEBH-DWGLLFKBSA-N |
| XLogP | 11.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.84 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|