C20H34O3 — CID 163018725
(2Z,6E,8R,10E,14Z)-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraene-1,8,16-triol (PubChem CID 163018725) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (2Z,6E,8R,10E,14Z)-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraene-1,8,16-triol.
| Compound Name | (2Z,6E,8R,10E,14Z)-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraene-1,8,16-triol |
|---|---|
| PubChem CID | 163018725 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (2Z,6E,8R,10E,14Z)-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraene-1,8,16-triol |
| SMILES | C/C(=C/CC/C(C)=C/[C@H](O)C/C(C)=C/CC/C(C)=C\CO)CO |
| InChI | InChI=1S/C20H34O3/c1-16(11-12-21)7-5-8-17(2)13-20(23)14-18(3)9-6-10-19(4)15-22/h8,10-11,14,20-23H,5-7,9,12-13,15H2,1-4H3/b16-11-,17-8+,18-14+,19-10-/t20-/m1/s1 |
| InChIKey | NGEXWFPIGXXDJN-UKQUAGIFSA-N |
| XLogP | 4.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|