C15H27NO3 — CID 163019269
(E,4S,5S)-4,5-dihydroxy-1-piperidin-1-yldec-2-en-1-one (PubChem CID 163019269) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is (E,4S,5S)-4,5-dihydroxy-1-piperidin-1-yldec-2-en-1-one.
| Compound Name | (E,4S,5S)-4,5-dihydroxy-1-piperidin-1-yldec-2-en-1-one |
|---|---|
| PubChem CID | 163019269 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (E,4S,5S)-4,5-dihydroxy-1-piperidin-1-yldec-2-en-1-one |
| SMILES | CCCCC[C@H](O)[C@@H](O)/C=C/C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H27NO3/c1-2-3-5-8-13(17)14(18)9-10-15(19)16-11-6-4-7-12-16/h9-10,13-14,17-18H,2-8,11-12H2,1H3/b10-9+/t13-,14-/m0/s1 |
| InChIKey | BFKPVZSEVYPLTK-KYXFNPKGSA-N |
| XLogP | 1.86 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|