C21H42O11 — CID 163019322
(2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-[(2S,3R,4S,5R)-1,2,4,5,6-pentamethoxyhexan-3-yl]oxyoxane (PubChem CID 163019322) has the molecular formula C21H42O11 and a molecular weight of 470.56 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-[(2S,3R,4S,5R)-1,2,4,5,6-pentamethoxyhexan-3-yl]oxyoxane.
| Compound Name | (2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-[(2S,3R,4S,5R)-1,2,4,5,6-pentamethoxyhexan-3-yl]oxyoxane |
|---|---|
| PubChem CID | 163019322 |
| Molecular Formula | C21H42O11 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | (2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-[(2S,3R,4S,5R)-1,2,4,5,6-pentamethoxyhexan-3-yl]oxyoxane |
| SMILES | COC[C@H](OC)[C@@H](O[C@H]1O[C@H](COC)[C@H](OC)[C@H](OC)[C@H]1OC)[C@@H](OC)[C@@H](COC)OC |
| InChI | InChI=1S/C21H42O11/c1-22-10-13(25-4)16(27-6)18(14(26-5)11-23-2)32-21-20(30-9)19(29-8)17(28-7)15(31-21)12-24-3/h13-21H,10-12H2,1-9H3/t13-,14+,15-,16+,17+,18-,19+,20-,21-/m1/s1 |
| InChIKey | QORZOJLEBCJYBI-JFBAWDOZSA-N |
| XLogP | 0.13 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |