C17H20O3 — CID 163019750
(8aR,10aS)-3-methoxy-8,10a-dimethyl-6,8a,9,10-tetrahydro-5H-anthracene-1,4-dione (PubChem CID 163019750) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is (8aR,10aS)-3-methoxy-8,10a-dimethyl-6,8a,9,10-tetrahydro-5H-anthracene-1,4-dione.
| Compound Name | (8aR,10aS)-3-methoxy-8,10a-dimethyl-6,8a,9,10-tetrahydro-5H-anthracene-1,4-dione |
|---|---|
| PubChem CID | 163019750 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (8aR,10aS)-3-methoxy-8,10a-dimethyl-6,8a,9,10-tetrahydro-5H-anthracene-1,4-dione |
| SMILES | COC1=CC(=O)C2=C(C[C@]3(C)CCC=C(C)[C@@H]3C2)C1=O |
| InChI | InChI=1S/C17H20O3/c1-10-5-4-6-17(2)9-12-11(7-13(10)17)14(18)8-15(20-3)16(12)19/h5,8,13H,4,6-7,9H2,1-3H3/t13-,17-/m0/s1 |
| InChIKey | JAAVCMIVHLOCJJ-GUYCJALGSA-N |
| XLogP | 3.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|