About (6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde
(6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 163020057) has the molecular formula C20H30O
and a molecular weight of 286.46 g/mol. Its IUPAC name is (6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | (6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 163020057 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CC(C)=CCCC1=CC=C(C=O)[C@](C)(CCC=C(C)C)C1 |
| InChI | InChI=1S/C20H30O/c1-16(2)8-6-10-18-11-12-19(15-21)20(5,14-18)13-7-9-17(3)4/h8-9,11-12,15H,6-7,10,13-14H2,1-5H3/t20-/m1/s1 |
| InChIKey | FENFKJSEQOAPKE-HXUWFJFHSA-N |
| XLogP | 5.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of (6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde (CID 163020057) is (6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for (6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for (6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde is CC(C)=CCCC1=CC=C(C=O)[C@](C)(CCC=C(C)C)C1.
What is the InChIKey of (6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is FENFKJSEQOAPKE-HXUWFJFHSA-N. The full InChI is InChI=1S/C20H30O/c1-16(2)8-6-10-18-11-12-19(15-21)20(5,14-18)13-7-9-17(3)4/h8-9,11-12,15H,6-7,10,13-14H2,1-5H3/t20-/m1/s1.
What are the key properties of (6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde?
(6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 286.46 g/mol, XLogP of 5.94, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-methyl-4,6-bis(4-methylpent-3-enyl)cyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 163020057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).