C20H32O2 — CID 163020551
[(1S,2S,5S,8R)-2,6,8-trimethyl-5-tricyclo[6.3.0.01,5]undec-6-enyl]methyl 3-methylbutanoate (PubChem CID 163020551) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is [(1S,2S,5S,8R)-2,6,8-trimethyl-5-tricyclo[6.3.0.01,5]undec-6-enyl]methyl 3-methylbutanoate.
| Compound Name | [(1S,2S,5S,8R)-2,6,8-trimethyl-5-tricyclo[6.3.0.01,5]undec-6-enyl]methyl 3-methylbutanoate |
|---|---|
| PubChem CID | 163020551 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | [(1S,2S,5S,8R)-2,6,8-trimethyl-5-tricyclo[6.3.0.01,5]undec-6-enyl]methyl 3-methylbutanoate |
| SMILES | CC1=C[C@@]2(C)CCC[C@]23[C@@H](C)CC[C@]13COC(=O)CC(C)C |
| InChI | InChI=1S/C20H32O2/c1-14(2)11-17(21)22-13-19-10-7-15(3)20(19)9-6-8-18(20,5)12-16(19)4/h12,14-15H,6-11,13H2,1-5H3/t15-,18+,19-,20-/m0/s1 |
| InChIKey | YVXQZEXPEQPMCZ-LDTOTXGLSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|