C31H44N2O6 — CID 163020827
1-(2-aminophenyl)-2-[[(1S,2S,3R,4S,5R,6S,8S,9R,10R,13S,16R,17S)-11-ethyl-8-hydroxy-4,6,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl]oxy]ethanone (PubChem CID 163020827) has the molecular formula C31H44N2O6 and a molecular weight of 540.70 g/mol. Its IUPAC name is 1-(2-aminophenyl)-2-[[(1S,2S,3R,4S,5R,6S,8S,9R,10R,13S,16R,17S)-11-ethyl-8-hydroxy-4,6,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl]oxy]ethanone.
| Compound Name | 1-(2-aminophenyl)-2-[[(1S,2S,3R,4S,5R,6S,8S,9R,10R,13S,16R,17S)-11-ethyl-8-hydroxy-4,6,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl]oxy]ethanone |
|---|---|
| PubChem CID | 163020827 |
| Molecular Formula | C31H44N2O6 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | 1-(2-aminophenyl)-2-[[(1S,2S,3R,4S,5R,6S,8S,9R,10R,13S,16R,17S)-11-ethyl-8-hydroxy-4,6,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl]oxy]ethanone |
| SMILES | CCN1C[C@]2(OCC(=O)c3ccccc3N)CC[C@@H](OC)[C@@]34[C@@H]2C[C@H]([C@@H]13)[C@@]1(O)C[C@H](OC)[C@H]2C[C@H]4[C@@H]1[C@H]2OC |
| InChI | InChI=1S/C31H44N2O6/c1-5-33-16-29(39-15-22(34)17-8-6-7-9-21(17)32)11-10-25(37-3)31-19-12-18-23(36-2)14-30(35,26(19)27(18)38-4)20(28(31)33)13-24(29)31/h6-9,18-20,23-28,35H,5,10-16,32H2,1-4H3/t18-,19+,20-,23+,24-,25-,26-,27+,28-,29-,30+,31-/m1/s1 |
| InChIKey | LNLNPACYBBAULC-XYVZJUNPSA-N |
| XLogP | 2.77 |
| TPSA | 103.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|