C28H45NO4 — CID 163021168
3,10-dihydroxy-9-[1-(3-hydroxy-1,5-dimethylpiperidin-2-yl)ethyl]-10,11b-dimethyl-1,2,3,4,4a,6,6a,8,9,10a,11,11a-dodecahydrobenzo[a]fluoren-5-one (PubChem CID 163021168) has the molecular formula C28H45NO4 and a molecular weight of 459.67 g/mol. Its IUPAC name is 3,10-dihydroxy-9-[1-(3-hydroxy-1,5-dimethylpiperidin-2-yl)ethyl]-10,11b-dimethyl-1,2,3,4,4a,6,6a,8,9,10a,11,11a-dodecahydrobenzo[a]fluoren-5-one.
| Compound Name | 3,10-dihydroxy-9-[1-(3-hydroxy-1,5-dimethylpiperidin-2-yl)ethyl]-10,11b-dimethyl-1,2,3,4,4a,6,6a,8,9,10a,11,11a-dodecahydrobenzo[a]fluoren-5-one |
|---|---|
| PubChem CID | 163021168 |
| Molecular Formula | C28H45NO4 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.33 |
| IUPAC Name | 3,10-dihydroxy-9-[1-(3-hydroxy-1,5-dimethylpiperidin-2-yl)ethyl]-10,11b-dimethyl-1,2,3,4,4a,6,6a,8,9,10a,11,11a-dodecahydrobenzo[a]fluoren-5-one |
| SMILES | CC1CC(O)C(C(C)C2CC=C3C4CC(=O)C5CC(O)CCC5(C)C4CC3C2(C)O)N(C)C1 |
| InChI | InChI=1S/C28H45NO4/c1-15-10-25(32)26(29(5)14-15)16(2)20-7-6-18-19-12-24(31)23-11-17(30)8-9-27(23,3)21(19)13-22(18)28(20,4)33/h6,15-17,19-23,25-26,30,32-33H,7-14H2,1-5H3 |
| InChIKey | CVNABROKRBTXMA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|