C19H26O — CID 163022006
(4aS,9R,10aS)-4a-methyl-1-methylidene-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-9-ol (PubChem CID 163022006) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is (4aS,9R,10aS)-4a-methyl-1-methylidene-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-9-ol.
| Compound Name | (4aS,9R,10aS)-4a-methyl-1-methylidene-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-9-ol |
|---|---|
| PubChem CID | 163022006 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (4aS,9R,10aS)-4a-methyl-1-methylidene-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-9-ol |
| SMILES | C=C1CCC[C@]2(C)c3ccc(C(C)C)cc3[C@H](O)C[C@@H]12 |
| InChI | InChI=1S/C19H26O/c1-12(2)14-7-8-16-15(10-14)18(20)11-17-13(3)6-5-9-19(16,17)4/h7-8,10,12,17-18,20H,3,5-6,9,11H2,1-2,4H3/t17-,18+,19+/m0/s1 |
| InChIKey | AKLPKLNHHIOFBG-IPMKNSEASA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|