C17H20O6 — CID 163022300
[(1R,2R,3R,6S,8E,11S)-3,8-dimethyl-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-8,12(15)-dien-11-yl] acetate (PubChem CID 163022300) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is [(1R,2R,3R,6S,8E,11S)-3,8-dimethyl-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-8,12(15)-dien-11-yl] acetate.
| Compound Name | [(1R,2R,3R,6S,8E,11S)-3,8-dimethyl-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-8,12(15)-dien-11-yl] acetate |
|---|---|
| PubChem CID | 163022300 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [(1R,2R,3R,6S,8E,11S)-3,8-dimethyl-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-8,12(15)-dien-11-yl] acetate |
| SMILES | CC(=O)O[C@H]1C/C=C(\C)C[C@@H]2OC(=O)[C@H](C)[C@H]2[C@H]2C=C1C(=O)O2 |
| InChI | InChI=1S/C17H20O6/c1-8-4-5-12(21-10(3)18)11-7-14(23-17(11)20)15-9(2)16(19)22-13(15)6-8/h4,7,9,12-15H,5-6H2,1-3H3/b8-4+/t9-,12+,13+,14-,15-/m1/s1 |
| InChIKey | MBSONWVPLADQOL-XPEONNQGSA-N |
| XLogP | 1.69 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|