C26H38O3 — CID 163023427
(1S,4R,5R,6R,10S,12S,13S,16R,21R)-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8,18-dione (PubChem CID 163023427) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (1S,4R,5R,6R,10S,12S,13S,16R,21R)-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8,18-dione.
| Compound Name | (1S,4R,5R,6R,10S,12S,13S,16R,21R)-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8,18-dione |
|---|---|
| PubChem CID | 163023427 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (1S,4R,5R,6R,10S,12S,13S,16R,21R)-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8,18-dione |
| SMILES | C[C@@H]1CC(=O)O[C@H]2C[C@@]3(C)[C@@H]4CC[C@H]5C(C)(C)C(=O)CC[C@@]56C[C@@]46CC[C@]3(C)[C@@H]12 |
| InChI | InChI=1S/C26H38O3/c1-15-12-20(28)29-16-13-24(5)18-7-6-17-22(2,3)19(27)8-9-25(17)14-26(18,25)11-10-23(24,4)21(15)16/h15-18,21H,6-14H2,1-5H3/t15-,16+,17+,18+,21+,23-,24+,25-,26+/m1/s1 |
| InChIKey | ANGQYAXZJIEVNR-AISQBGLESA-N |
| XLogP | 5.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |